C28H29N3O5 — CID 129391762
(2R)-N-[(3,5-dimethoxyphenyl)methyl]-2-methyl-N'-[(7R)-5-methyl-6-oxo-7H-benzo[d][1]benzazepin-7-yl]propanediamide (PubChem CID 129391762) has the molecular formula C28H29N3O5 and a molecular weight of 487.56 g/mol. Its IUPAC name is (2R)-N-[(3,5-dimethoxyphenyl)methyl]-2-methyl-N'-[(7R)-5-methyl-6-oxo-7H-benzo[d][1]benzazepin-7-yl]propanediamide.
| Compound Name | (2R)-N-[(3,5-dimethoxyphenyl)methyl]-2-methyl-N'-[(7R)-5-methyl-6-oxo-7H-benzo[d][1]benzazepin-7-yl]propanediamide |
|---|---|
| PubChem CID | 129391762 |
| Molecular Formula | C28H29N3O5 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | (2R)-N-[(3,5-dimethoxyphenyl)methyl]-2-methyl-N'-[(7R)-5-methyl-6-oxo-7H-benzo[d][1]benzazepin-7-yl]propanediamide |
| SMILES | COc1cc(CNC(=O)[C@@H](C)C(=O)N[C@H]2C(=O)N(C)c3ccccc3-c3ccccc32)cc(OC)c1 |
| InChI | InChI=1S/C28H29N3O5/c1-17(26(32)29-16-18-13-19(35-3)15-20(14-18)36-4)27(33)30-25-23-11-6-5-9-21(23)22-10-7-8-12-24(22)31(2)28(25)34/h5-15,17,25H,16H2,1-4H3,(H,29,32)(H,30,33)/t17-,25-/m1/s1 |
| InChIKey | UIKFKYDDOJQJRG-CRICUBBOSA-N |
| XLogP | 3.46 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|