C18H19N — CID 129392517
(4aR,9bS)-4a-phenyl-1,2,3,4,5,9b-hexahydroindeno[1,2-b]pyridine (PubChem CID 129392517) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is (4aR,9bS)-4a-phenyl-1,2,3,4,5,9b-hexahydroindeno[1,2-b]pyridine.
| Compound Name | (4aR,9bS)-4a-phenyl-1,2,3,4,5,9b-hexahydroindeno[1,2-b]pyridine |
|---|---|
| PubChem CID | 129392517 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (4aR,9bS)-4a-phenyl-1,2,3,4,5,9b-hexahydroindeno[1,2-b]pyridine |
| SMILES | c1ccc([C@]23CCCN[C@@H]2c2ccccc2C3)cc1 |
| InChI | InChI=1S/C18H19N/c1-2-8-15(9-3-1)18-11-6-12-19-17(18)16-10-5-4-7-14(16)13-18/h1-5,7-10,17,19H,6,11-13H2/t17-,18-/m1/s1 |
| InChIKey | KNZJGWSYCJGDEY-QZTJIDSGSA-N |
| XLogP | 3.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |