C16H27N3O — CID 129392773
(2R)-1-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]-2-(1-methylpyrazol-4-yl)propan-2-ol (PubChem CID 129392773) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is (2R)-1-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]-2-(1-methylpyrazol-4-yl)propan-2-ol.
| Compound Name | (2R)-1-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]-2-(1-methylpyrazol-4-yl)propan-2-ol |
|---|---|
| PubChem CID | 129392773 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | (2R)-1-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]-2-(1-methylpyrazol-4-yl)propan-2-ol |
| SMILES | CC1=CCC[C@H](C)[C@@H]1CNC[C@](C)(O)c1cnn(C)c1 |
| InChI | InChI=1S/C16H27N3O/c1-12-6-5-7-13(2)15(12)9-17-11-16(3,20)14-8-18-19(4)10-14/h6,8,10,13,15,17,20H,5,7,9,11H2,1-4H3/t13-,15+,16-/m0/s1 |
| InChIKey | LYYZQOAPWOXVOH-IMJJTQAJSA-N |
| XLogP | 2.21 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|