C18H18ClFN2O2 — CID 129393354
(3R)-N-[2-(4-chlorophenyl)-4-fluorophenyl]-3-(hydroxymethyl)pyrrolidine-1-carboxamide (PubChem CID 129393354) has the molecular formula C18H18ClFN2O2 and a molecular weight of 348.81 g/mol. Its IUPAC name is (3R)-N-[2-(4-chlorophenyl)-4-fluorophenyl]-3-(hydroxymethyl)pyrrolidine-1-carboxamide.
| Compound Name | (3R)-N-[2-(4-chlorophenyl)-4-fluorophenyl]-3-(hydroxymethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 129393354 |
| Molecular Formula | C18H18ClFN2O2 |
| Molecular Weight | 348.81 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | (3R)-N-[2-(4-chlorophenyl)-4-fluorophenyl]-3-(hydroxymethyl)pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1-c1ccc(Cl)cc1)N1CC[C@@H](CO)C1 |
| InChI | InChI=1S/C18H18ClFN2O2/c19-14-3-1-13(2-4-14)16-9-15(20)5-6-17(16)21-18(24)22-8-7-12(10-22)11-23/h1-6,9,12,23H,7-8,10-11H2,(H,21,24)/t12-/m1/s1 |
| InChIKey | IXUYPMMRWVLMCQ-GFCCVEGCSA-N |
| XLogP | 3.99 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.81 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |