C14H21NO2 — CID 129394205
4-[2-[[(1S,2R)-2-hydroxycyclohexyl]amino]ethyl]phenol (PubChem CID 129394205) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 4-[2-[[(1S,2R)-2-hydroxycyclohexyl]amino]ethyl]phenol.
| Compound Name | 4-[2-[[(1S,2R)-2-hydroxycyclohexyl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 129394205 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 4-[2-[[(1S,2R)-2-hydroxycyclohexyl]amino]ethyl]phenol |
| SMILES | Oc1ccc(CCN[C@H]2CCCC[C@H]2O)cc1 |
| InChI | InChI=1S/C14H21NO2/c16-12-7-5-11(6-8-12)9-10-15-13-3-1-2-4-14(13)17/h5-8,13-17H,1-4,9-10H2/t13-,14+/m0/s1 |
| InChIKey | YCIVAWHIAKUWTH-UONOGXRCSA-N |
| XLogP | 1.83 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |