C12H15Cl2F3N2O — CID 129394502
(2S)-1-[(2,6-dichloro-4-methyl-3-pyridinyl)methyl-methylamino]-4,4,4-trifluorobutan-2-ol (PubChem CID 129394502) has the molecular formula C12H15Cl2F3N2O and a molecular weight of 331.17 g/mol. Its IUPAC name is (2S)-1-[(2,6-dichloro-4-methyl-3-pyridinyl)methyl-methylamino]-4,4,4-trifluorobutan-2-ol.
| Compound Name | (2S)-1-[(2,6-dichloro-4-methyl-3-pyridinyl)methyl-methylamino]-4,4,4-trifluorobutan-2-ol |
|---|---|
| PubChem CID | 129394502 |
| Molecular Formula | C12H15Cl2F3N2O |
| Molecular Weight | 331.17 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | (2S)-1-[(2,6-dichloro-4-methyl-3-pyridinyl)methyl-methylamino]-4,4,4-trifluorobutan-2-ol |
| SMILES | Cc1cc(Cl)nc(Cl)c1CN(C)C[C@@H](O)CC(F)(F)F |
| InChI | InChI=1S/C12H15Cl2F3N2O/c1-7-3-10(13)18-11(14)9(7)6-19(2)5-8(20)4-12(15,16)17/h3,8,20H,4-6H2,1-2H3/t8-/m0/s1 |
| InChIKey | RFZJUTHRDJVAOS-QMMMGPOBSA-N |
| XLogP | 3.44 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.17 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|