About [(2R)-7-cyclopentyl-2,3-dihydro-1-benzofuran-2-yl]methanamine
[(2R)-7-cyclopentyl-2,3-dihydro-1-benzofuran-2-yl]methanamine (PubChem CID 129394656) has the molecular formula C14H19NO
and a molecular weight of 217.31 g/mol. Its IUPAC name is [(2R)-7-cyclopentyl-2,3-dihydro-1-benzofuran-2-yl]methanamine.
Molecular Properties
| Compound Name | [(2R)-7-cyclopentyl-2,3-dihydro-1-benzofuran-2-yl]methanamine |
| PubChem CID | 129394656 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | [(2R)-7-cyclopentyl-2,3-dihydro-1-benzofuran-2-yl]methanamine |
| SMILES | NC[C@H]1Cc2cccc(C3CCCC3)c2O1 |
| InChI | InChI=1S/C14H19NO/c15-9-12-8-11-6-3-7-13(14(11)16-12)10-4-1-2-5-10/h3,6-7,10,12H,1-2,4-5,8-9,15H2/t12-/m1/s1 |
| InChIKey | XKGGSPJXGUCRJL-GFCCVEGCSA-N |
| XLogP | 2.61 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2R)-7-cyclopentyl-2,3-dihydro-1-benzofuran-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-7-cyclopentyl-2,3-dihydro-1-benzofuran-2-yl]methanamine?
The IUPAC name of [(2R)-7-cyclopentyl-2,3-dihydro-1-benzofuran-2-yl]methanamine (CID 129394656) is [(2R)-7-cyclopentyl-2,3-dihydro-1-benzofuran-2-yl]methanamine.
What is the SMILES notation for [(2R)-7-cyclopentyl-2,3-dihydro-1-benzofuran-2-yl]methanamine?
The canonical SMILES for [(2R)-7-cyclopentyl-2,3-dihydro-1-benzofuran-2-yl]methanamine is NC[C@H]1Cc2cccc(C3CCCC3)c2O1.
What is the InChIKey of [(2R)-7-cyclopentyl-2,3-dihydro-1-benzofuran-2-yl]methanamine?
The InChIKey is XKGGSPJXGUCRJL-GFCCVEGCSA-N. The full InChI is InChI=1S/C14H19NO/c15-9-12-8-11-6-3-7-13(14(11)16-12)10-4-1-2-5-10/h3,6-7,10,12H,1-2,4-5,8-9,15H2/t12-/m1/s1.
What are the key properties of [(2R)-7-cyclopentyl-2,3-dihydro-1-benzofuran-2-yl]methanamine?
[(2R)-7-cyclopentyl-2,3-dihydro-1-benzofuran-2-yl]methanamine has a molecular weight of 217.31 g/mol, XLogP of 2.61, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-7-cyclopentyl-2,3-dihydro-1-benzofuran-2-yl]methanamine is sourced from PubChem (CID 129394656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).