C8H13Br2NO3 — CID 129394839
ethyl 2-[[(2S)-2,4-dibromobutanoyl]amino]acetate (PubChem CID 129394839) has the molecular formula C8H13Br2NO3 and a molecular weight of 331.00 g/mol. Its IUPAC name is ethyl 2-[[(2S)-2,4-dibromobutanoyl]amino]acetate.
| Compound Name | ethyl 2-[[(2S)-2,4-dibromobutanoyl]amino]acetate |
|---|---|
| PubChem CID | 129394839 |
| Molecular Formula | C8H13Br2NO3 |
| Molecular Weight | 331.00 g/mol |
| Exact Mass | 328.93 |
| IUPAC Name | ethyl 2-[[(2S)-2,4-dibromobutanoyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)[C@@H](Br)CCBr |
| InChI | InChI=1S/C8H13Br2NO3/c1-2-14-7(12)5-11-8(13)6(10)3-4-9/h6H,2-5H2,1H3,(H,11,13)/t6-/m0/s1 |
| InChIKey | UTOBIGIPSJPXEX-LURJTMIESA-N |
| XLogP | 1.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.00 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|