C22H19F4NO6 — CID 129394889
ethyl (2R,3R)-2-(2-fluoro-6-methoxyphenyl)-4,5-dioxo-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrrolidine-3-carboxylate (PubChem CID 129394889) has the molecular formula C22H19F4NO6 and a molecular weight of 469.39 g/mol. Its IUPAC name is ethyl (2R,3R)-2-(2-fluoro-6-methoxyphenyl)-4,5-dioxo-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrrolidine-3-carboxylate.
| Compound Name | ethyl (2R,3R)-2-(2-fluoro-6-methoxyphenyl)-4,5-dioxo-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 129394889 |
| Molecular Formula | C22H19F4NO6 |
| Molecular Weight | 469.39 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | ethyl (2R,3R)-2-(2-fluoro-6-methoxyphenyl)-4,5-dioxo-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)C(=O)N(Cc2ccc(OC(F)(F)F)cc2)[C@H]1c1c(F)cccc1OC |
| InChI | InChI=1S/C22H19F4NO6/c1-3-32-21(30)17-18(16-14(23)5-4-6-15(16)31-2)27(20(29)19(17)28)11-12-7-9-13(10-8-12)33-22(24,25)26/h4-10,17-18H,3,11H2,1-2H3/t17-,18+/m1/s1 |
| InChIKey | JKCUTYHCGWGNTF-MSOLQXFVSA-N |
| XLogP | 3.56 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|