About (11S)-9-methyl-5,11-dihydro-[1]benzoxepino[3,4-b]pyridin-11-ol
(11S)-9-methyl-5,11-dihydro-[1]benzoxepino[3,4-b]pyridin-11-ol (PubChem CID 129395201) has the molecular formula C14H13NO2
and a molecular weight of 227.26 g/mol. Its IUPAC name is (11S)-9-methyl-5,11-dihydro-[1]benzoxepino[3,4-b]pyridin-11-ol.
Molecular Properties
| Compound Name | (11S)-9-methyl-5,11-dihydro-[1]benzoxepino[3,4-b]pyridin-11-ol |
| PubChem CID | 129395201 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | (11S)-9-methyl-5,11-dihydro-[1]benzoxepino[3,4-b]pyridin-11-ol |
| SMILES | Cc1ccc2c(c1)[C@@H](O)c1cccnc1CO2 |
| InChI | InChI=1S/C14H13NO2/c1-9-4-5-13-11(7-9)14(16)10-3-2-6-15-12(10)8-17-13/h2-7,14,16H,8H2,1H3/t14-/m0/s1 |
| InChIKey | WZTRQSMHRONCDP-AWEZNQCLSA-N |
| XLogP | 2.36 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (11S)-9-methyl-5,11-dihydro-[1]benzoxepino[3,4-b]pyridin-11-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (11S)-9-methyl-5,11-dihydro-[1]benzoxepino[3,4-b]pyridin-11-ol?
The IUPAC name of (11S)-9-methyl-5,11-dihydro-[1]benzoxepino[3,4-b]pyridin-11-ol (CID 129395201) is (11S)-9-methyl-5,11-dihydro-[1]benzoxepino[3,4-b]pyridin-11-ol.
What is the SMILES notation for (11S)-9-methyl-5,11-dihydro-[1]benzoxepino[3,4-b]pyridin-11-ol?
The canonical SMILES for (11S)-9-methyl-5,11-dihydro-[1]benzoxepino[3,4-b]pyridin-11-ol is Cc1ccc2c(c1)[C@@H](O)c1cccnc1CO2.
What is the InChIKey of (11S)-9-methyl-5,11-dihydro-[1]benzoxepino[3,4-b]pyridin-11-ol?
The InChIKey is WZTRQSMHRONCDP-AWEZNQCLSA-N. The full InChI is InChI=1S/C14H13NO2/c1-9-4-5-13-11(7-9)14(16)10-3-2-6-15-12(10)8-17-13/h2-7,14,16H,8H2,1H3/t14-/m0/s1.
What are the key properties of (11S)-9-methyl-5,11-dihydro-[1]benzoxepino[3,4-b]pyridin-11-ol?
(11S)-9-methyl-5,11-dihydro-[1]benzoxepino[3,4-b]pyridin-11-ol has a molecular weight of 227.26 g/mol, XLogP of 2.36, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (11S)-9-methyl-5,11-dihydro-[1]benzoxepino[3,4-b]pyridin-11-ol is sourced from PubChem (CID 129395201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).