C15H23N3 — CID 129395359
(8R)-8-(4-methylpiperazin-1-yl)-5,6,7,8-tetrahydronaphthalen-2-amine (PubChem CID 129395359) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is (8R)-8-(4-methylpiperazin-1-yl)-5,6,7,8-tetrahydronaphthalen-2-amine.
| Compound Name | (8R)-8-(4-methylpiperazin-1-yl)-5,6,7,8-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 129395359 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | (8R)-8-(4-methylpiperazin-1-yl)-5,6,7,8-tetrahydronaphthalen-2-amine |
| SMILES | CN1CCN([C@@H]2CCCc3ccc(N)cc32)CC1 |
| InChI | InChI=1S/C15H23N3/c1-17-7-9-18(10-8-17)15-4-2-3-12-5-6-13(16)11-14(12)15/h5-6,11,15H,2-4,7-10,16H2,1H3/t15-/m1/s1 |
| InChIKey | KEJNMVNVPVRJHL-OAHLLOKOSA-N |
| XLogP | 1.89 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|