About (2R)-2-[(3R)-3-[2-(3,4-dichlorophenyl)sulfanylphenoxy]pyrrolidin-1-yl]propanoic acid
(2R)-2-[(3R)-3-[2-(3,4-dichlorophenyl)sulfanylphenoxy]pyrrolidin-1-yl]propanoic acid (PubChem CID 129395497) has the molecular formula C19H19Cl2NO3S
and a molecular weight of 412.34 g/mol. Its IUPAC name is (2R)-2-[(3R)-3-[2-(3,4-dichlorophenyl)sulfanylphenoxy]pyrrolidin-1-yl]propanoic acid.
Molecular Properties
| Compound Name | (2R)-2-[(3R)-3-[2-(3,4-dichlorophenyl)sulfanylphenoxy]pyrrolidin-1-yl]propanoic acid |
| PubChem CID | 129395497 |
| Molecular Formula | C19H19Cl2NO3S |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | (2R)-2-[(3R)-3-[2-(3,4-dichlorophenyl)sulfanylphenoxy]pyrrolidin-1-yl]propanoic acid |
| SMILES | C[C@H](C(=O)O)N1CC[C@@H](Oc2ccccc2Sc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C19H19Cl2NO3S/c1-12(19(23)24)22-9-8-13(11-22)25-17-4-2-3-5-18(17)26-14-6-7-15(20)16(21)10-14/h2-7,10,12-13H,8-9,11H2,1H3,(H,23,24)/t12-,13-/m1/s1 |
| InChIKey | PPPKGUUFAXPBOP-CHWSQXEVSA-N |
| XLogP | 5.07 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-[(3R)-3-[2-(3,4-dichlorophenyl)sulfanylphenoxy]pyrrolidin-1-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(3R)-3-[2-(3,4-dichlorophenyl)sulfanylphenoxy]pyrrolidin-1-yl]propanoic acid?
The IUPAC name of (2R)-2-[(3R)-3-[2-(3,4-dichlorophenyl)sulfanylphenoxy]pyrrolidin-1-yl]propanoic acid (CID 129395497) is (2R)-2-[(3R)-3-[2-(3,4-dichlorophenyl)sulfanylphenoxy]pyrrolidin-1-yl]propanoic acid.
What is the SMILES notation for (2R)-2-[(3R)-3-[2-(3,4-dichlorophenyl)sulfanylphenoxy]pyrrolidin-1-yl]propanoic acid?
The canonical SMILES for (2R)-2-[(3R)-3-[2-(3,4-dichlorophenyl)sulfanylphenoxy]pyrrolidin-1-yl]propanoic acid is C[C@H](C(=O)O)N1CC[C@@H](Oc2ccccc2Sc2ccc(Cl)c(Cl)c2)C1.
What is the InChIKey of (2R)-2-[(3R)-3-[2-(3,4-dichlorophenyl)sulfanylphenoxy]pyrrolidin-1-yl]propanoic acid?
The InChIKey is PPPKGUUFAXPBOP-CHWSQXEVSA-N. The full InChI is InChI=1S/C19H19Cl2NO3S/c1-12(19(23)24)22-9-8-13(11-22)25-17-4-2-3-5-18(17)26-14-6-7-15(20)16(21)10-14/h2-7,10,12-13H,8-9,11H2,1H3,(H,23,24)/t12-,13-/m1/s1.
What are the key properties of (2R)-2-[(3R)-3-[2-(3,4-dichlorophenyl)sulfanylphenoxy]pyrrolidin-1-yl]propanoic acid?
(2R)-2-[(3R)-3-[2-(3,4-dichlorophenyl)sulfanylphenoxy]pyrrolidin-1-yl]propanoic acid has a molecular weight of 412.34 g/mol, XLogP of 5.07, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(3R)-3-[2-(3,4-dichlorophenyl)sulfanylphenoxy]pyrrolidin-1-yl]propanoic acid is sourced from PubChem (CID 129395497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).