C14H13ClFN3O2 — CID 129395606
methyl (4S,6R)-4-(3-chloro-2-fluorophenyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-6-carboxylate (PubChem CID 129395606) has the molecular formula C14H13ClFN3O2 and a molecular weight of 309.73 g/mol. Its IUPAC name is methyl (4S,6R)-4-(3-chloro-2-fluorophenyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-6-carboxylate.
| Compound Name | methyl (4S,6R)-4-(3-chloro-2-fluorophenyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 129395606 |
| Molecular Formula | C14H13ClFN3O2 |
| Molecular Weight | 309.73 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | methyl (4S,6R)-4-(3-chloro-2-fluorophenyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-6-carboxylate |
| SMILES | COC(=O)[C@H]1Cc2[nH]cnc2[C@H](c2cccc(Cl)c2F)N1 |
| InChI | InChI=1S/C14H13ClFN3O2/c1-21-14(20)10-5-9-13(18-6-17-9)12(19-10)7-3-2-4-8(15)11(7)16/h2-4,6,10,12,19H,5H2,1H3,(H,17,18)/t10-,12+/m1/s1 |
| InChIKey | HLOPSGPRMGMMRU-PWSUYJOCSA-N |
| XLogP | 1.98 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.73 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |