C18H23NO5 — CID 129396234
4-[(1S)-1-(methylamino)-2-(3,4,5-trimethoxyphenyl)ethyl]benzene-1,2-diol (PubChem CID 129396234) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is 4-[(1S)-1-(methylamino)-2-(3,4,5-trimethoxyphenyl)ethyl]benzene-1,2-diol.
| Compound Name | 4-[(1S)-1-(methylamino)-2-(3,4,5-trimethoxyphenyl)ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 129396234 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 4-[(1S)-1-(methylamino)-2-(3,4,5-trimethoxyphenyl)ethyl]benzene-1,2-diol |
| SMILES | CN[C@@H](Cc1cc(OC)c(OC)c(OC)c1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C18H23NO5/c1-19-13(12-5-6-14(20)15(21)10-12)7-11-8-16(22-2)18(24-4)17(9-11)23-3/h5-6,8-10,13,19-21H,7H2,1-4H3/t13-/m0/s1 |
| InChIKey | VCAIQJBZGWLUNG-ZDUSSCGKSA-N |
| XLogP | 2.63 |
| TPSA | 80.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|