C32H26O6 — CID 129396733
3,3-bis(3,8-dimethoxynaphthalen-2-yl)-2-benzofuran-1-one (PubChem CID 129396733) has the molecular formula C32H26O6 and a molecular weight of 506.55 g/mol. Its IUPAC name is 3,3-bis(3,8-dimethoxynaphthalen-2-yl)-2-benzofuran-1-one.
| Compound Name | 3,3-bis(3,8-dimethoxynaphthalen-2-yl)-2-benzofuran-1-one |
|---|---|
| PubChem CID | 129396733 |
| Molecular Formula | C32H26O6 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | 3,3-bis(3,8-dimethoxynaphthalen-2-yl)-2-benzofuran-1-one |
| SMILES | COc1cc2cccc(OC)c2cc1C1(c2cc3c(OC)cccc3cc2OC)OC(=O)c2ccccc21 |
| InChI | InChI=1S/C32H26O6/c1-34-27-13-7-9-19-15-29(36-3)25(17-22(19)27)32(24-12-6-5-11-21(24)31(33)38-32)26-18-23-20(16-30(26)37-4)10-8-14-28(23)35-2/h5-18H,1-4H3 |
| InChIKey | JWERYVBLTPJBHT-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |