C17H20N4O2S — CID 129397398
N-[(8R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3,4-dihydronaphthalene-2-sulfonamide (PubChem CID 129397398) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is N-[(8R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3,4-dihydronaphthalene-2-sulfonamide.
| Compound Name | N-[(8R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3,4-dihydronaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 129397398 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N-[(8R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3,4-dihydronaphthalene-2-sulfonamide |
| SMILES | Cc1nc2n(n1)CCC[C@H]2NS(=O)(=O)C1=Cc2ccccc2CC1 |
| InChI | InChI=1S/C17H20N4O2S/c1-12-18-17-16(7-4-10-21(17)19-12)20-24(22,23)15-9-8-13-5-2-3-6-14(13)11-15/h2-3,5-6,11,16,20H,4,7-10H2,1H3/t16-/m1/s1 |
| InChIKey | LORHWTUURZYZCL-MRXNPFEDSA-N |
| XLogP | 2.33 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |