C14H17F3N2O3 — CID 129398766
methyl 2-methoxy-6-[(3R)-3-(trifluoromethyl)piperidin-1-yl]pyridine-3-carboxylate (PubChem CID 129398766) has the molecular formula C14H17F3N2O3 and a molecular weight of 318.30 g/mol. Its IUPAC name is methyl 2-methoxy-6-[(3R)-3-(trifluoromethyl)piperidin-1-yl]pyridine-3-carboxylate.
| Compound Name | methyl 2-methoxy-6-[(3R)-3-(trifluoromethyl)piperidin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 129398766 |
| Molecular Formula | C14H17F3N2O3 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | methyl 2-methoxy-6-[(3R)-3-(trifluoromethyl)piperidin-1-yl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(N2CCC[C@@H](C(F)(F)F)C2)nc1OC |
| InChI | InChI=1S/C14H17F3N2O3/c1-21-12-10(13(20)22-2)5-6-11(18-12)19-7-3-4-9(8-19)14(15,16)17/h5-6,9H,3-4,7-8H2,1-2H3/t9-/m1/s1 |
| InChIKey | OMISFKFNLDQCIF-SECBINFHSA-N |
| XLogP | 2.66 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |