C15H16F2N2O2 — CID 129398822
(2S)-N-[(1S)-1-(3,4-difluorophenyl)-2-methylprop-2-enyl]-5-oxopyrrolidine-2-carboxamide (PubChem CID 129398822) has the molecular formula C15H16F2N2O2 and a molecular weight of 294.30 g/mol. Its IUPAC name is (2S)-N-[(1S)-1-(3,4-difluorophenyl)-2-methylprop-2-enyl]-5-oxopyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(1S)-1-(3,4-difluorophenyl)-2-methylprop-2-enyl]-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 129398822 |
| Molecular Formula | C15H16F2N2O2 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | (2S)-N-[(1S)-1-(3,4-difluorophenyl)-2-methylprop-2-enyl]-5-oxopyrrolidine-2-carboxamide |
| SMILES | C=C(C)[C@H](NC(=O)[C@@H]1CCC(=O)N1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H16F2N2O2/c1-8(2)14(9-3-4-10(16)11(17)7-9)19-15(21)12-5-6-13(20)18-12/h3-4,7,12,14H,1,5-6H2,2H3,(H,18,20)(H,19,21)/t12-,14-/m0/s1 |
| InChIKey | RVMCIDQNYFWCFK-JSGCOSHPSA-N |
| XLogP | 1.98 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|