C20H26N6 — CID 129400265
2-[(1S)-1-(1-cyclohexyltetrazol-5-yl)ethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 129400265) has the molecular formula C20H26N6 and a molecular weight of 350.47 g/mol. Its IUPAC name is 2-[(1S)-1-(1-cyclohexyltetrazol-5-yl)ethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 2-[(1S)-1-(1-cyclohexyltetrazol-5-yl)ethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 129400265 |
| Molecular Formula | C20H26N6 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 2-[(1S)-1-(1-cyclohexyltetrazol-5-yl)ethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C[C@@H](c1nnnn1C1CCCCC1)N1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C20H26N6/c1-14(20-22-23-24-26(20)15-7-3-2-4-8-15)25-12-11-17-16-9-5-6-10-18(16)21-19(17)13-25/h5-6,9-10,14-15,21H,2-4,7-8,11-13H2,1H3/t14-/m0/s1 |
| InChIKey | CLBANSNKQSSCKI-AWEZNQCLSA-N |
| XLogP | 3.78 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|