About N-[(1S)-1-(2,5-dimethylthiophen-3-yl)ethyl]-2-pyrrolidin-1-ylethanesulfonamide
N-[(1S)-1-(2,5-dimethylthiophen-3-yl)ethyl]-2-pyrrolidin-1-ylethanesulfonamide (PubChem CID 129400273) has the molecular formula C14H24N2O2S2
and a molecular weight of 316.49 g/mol. Its IUPAC name is N-[(1S)-1-(2,5-dimethylthiophen-3-yl)ethyl]-2-pyrrolidin-1-ylethanesulfonamide.
Molecular Properties
| Compound Name | N-[(1S)-1-(2,5-dimethylthiophen-3-yl)ethyl]-2-pyrrolidin-1-ylethanesulfonamide |
| PubChem CID | 129400273 |
| Molecular Formula | C14H24N2O2S2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | N-[(1S)-1-(2,5-dimethylthiophen-3-yl)ethyl]-2-pyrrolidin-1-ylethanesulfonamide |
| SMILES | Cc1cc([C@H](C)NS(=O)(=O)CCN2CCCC2)c(C)s1 |
| InChI | InChI=1S/C14H24N2O2S2/c1-11-10-14(13(3)19-11)12(2)15-20(17,18)9-8-16-6-4-5-7-16/h10,12,15H,4-9H2,1-3H3/t12-/m0/s1 |
| InChIKey | NUXSUGRVIZXBLO-LBPRGKRZSA-N |
| XLogP | 2.44 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(1S)-1-(2,5-dimethylthiophen-3-yl)ethyl]-2-pyrrolidin-1-ylethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S)-1-(2,5-dimethylthiophen-3-yl)ethyl]-2-pyrrolidin-1-ylethanesulfonamide?
The IUPAC name of N-[(1S)-1-(2,5-dimethylthiophen-3-yl)ethyl]-2-pyrrolidin-1-ylethanesulfonamide (CID 129400273) is N-[(1S)-1-(2,5-dimethylthiophen-3-yl)ethyl]-2-pyrrolidin-1-ylethanesulfonamide.
What is the SMILES notation for N-[(1S)-1-(2,5-dimethylthiophen-3-yl)ethyl]-2-pyrrolidin-1-ylethanesulfonamide?
The canonical SMILES for N-[(1S)-1-(2,5-dimethylthiophen-3-yl)ethyl]-2-pyrrolidin-1-ylethanesulfonamide is Cc1cc([C@H](C)NS(=O)(=O)CCN2CCCC2)c(C)s1.
What is the InChIKey of N-[(1S)-1-(2,5-dimethylthiophen-3-yl)ethyl]-2-pyrrolidin-1-ylethanesulfonamide?
The InChIKey is NUXSUGRVIZXBLO-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H24N2O2S2/c1-11-10-14(13(3)19-11)12(2)15-20(17,18)9-8-16-6-4-5-7-16/h10,12,15H,4-9H2,1-3H3/t12-/m0/s1.
What are the key properties of N-[(1S)-1-(2,5-dimethylthiophen-3-yl)ethyl]-2-pyrrolidin-1-ylethanesulfonamide?
N-[(1S)-1-(2,5-dimethylthiophen-3-yl)ethyl]-2-pyrrolidin-1-ylethanesulfonamide has a molecular weight of 316.49 g/mol, XLogP of 2.44, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S)-1-(2,5-dimethylthiophen-3-yl)ethyl]-2-pyrrolidin-1-ylethanesulfonamide is sourced from PubChem (CID 129400273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).