C18H26N2O3 — CID 129400358
(2R,6R)-2-(hydroxymethyl)-6-methyl-N-[(1S)-1-phenylpent-4-enyl]morpholine-4-carboxamide (PubChem CID 129400358) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is (2R,6R)-2-(hydroxymethyl)-6-methyl-N-[(1S)-1-phenylpent-4-enyl]morpholine-4-carboxamide.
| Compound Name | (2R,6R)-2-(hydroxymethyl)-6-methyl-N-[(1S)-1-phenylpent-4-enyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 129400358 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (2R,6R)-2-(hydroxymethyl)-6-methyl-N-[(1S)-1-phenylpent-4-enyl]morpholine-4-carboxamide |
| SMILES | C=CCC[C@H](NC(=O)N1C[C@H](CO)O[C@H](C)C1)c1ccccc1 |
| InChI | InChI=1S/C18H26N2O3/c1-3-4-10-17(15-8-6-5-7-9-15)19-18(22)20-11-14(2)23-16(12-20)13-21/h3,5-9,14,16-17,21H,1,4,10-13H2,2H3,(H,19,22)/t14-,16-,17+/m1/s1 |
| InChIKey | MWKAZXJXJTXUAG-OIISXLGYSA-N |
| XLogP | 2.49 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|