About (3R)-3-hydroxy-N-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]thiolane-3-carboxamide
(3R)-3-hydroxy-N-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]thiolane-3-carboxamide (PubChem CID 129400490) has the molecular formula C16H21NO3S
and a molecular weight of 307.41 g/mol. Its IUPAC name is (3R)-3-hydroxy-N-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]thiolane-3-carboxamide.
Molecular Properties
| Compound Name | (3R)-3-hydroxy-N-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]thiolane-3-carboxamide |
| PubChem CID | 129400490 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (3R)-3-hydroxy-N-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]thiolane-3-carboxamide |
| SMILES | O=C(NC[C@@H]1CCO[C@H]1c1ccccc1)[C@]1(O)CCSC1 |
| InChI | InChI=1S/C16H21NO3S/c18-15(16(19)7-9-21-11-16)17-10-13-6-8-20-14(13)12-4-2-1-3-5-12/h1-5,13-14,19H,6-11H2,(H,17,18)/t13-,14-,16-/m0/s1 |
| InChIKey | OGNNSYHGUZDHKW-DZKIICNBSA-N |
| XLogP | 1.75 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-3-hydroxy-N-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]thiolane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-hydroxy-N-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]thiolane-3-carboxamide?
The IUPAC name of (3R)-3-hydroxy-N-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]thiolane-3-carboxamide (CID 129400490) is (3R)-3-hydroxy-N-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]thiolane-3-carboxamide.
What is the SMILES notation for (3R)-3-hydroxy-N-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]thiolane-3-carboxamide?
The canonical SMILES for (3R)-3-hydroxy-N-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]thiolane-3-carboxamide is O=C(NC[C@@H]1CCO[C@H]1c1ccccc1)[C@]1(O)CCSC1.
What is the InChIKey of (3R)-3-hydroxy-N-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]thiolane-3-carboxamide?
The InChIKey is OGNNSYHGUZDHKW-DZKIICNBSA-N. The full InChI is InChI=1S/C16H21NO3S/c18-15(16(19)7-9-21-11-16)17-10-13-6-8-20-14(13)12-4-2-1-3-5-12/h1-5,13-14,19H,6-11H2,(H,17,18)/t13-,14-,16-/m0/s1.
What are the key properties of (3R)-3-hydroxy-N-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]thiolane-3-carboxamide?
(3R)-3-hydroxy-N-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]thiolane-3-carboxamide has a molecular weight of 307.41 g/mol, XLogP of 1.75, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-hydroxy-N-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]thiolane-3-carboxamide is sourced from PubChem (CID 129400490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).