C18H26N2O3 — CID 129401802
(E)-N-[[(1R,3S)-3-ethoxy-1-hydroxy-2,2-dimethylcyclobutyl]methyl]-3-(5-methyl-3-pyridinyl)prop-2-enamide (PubChem CID 129401802) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is (E)-N-[[(1R,3S)-3-ethoxy-1-hydroxy-2,2-dimethylcyclobutyl]methyl]-3-(5-methyl-3-pyridinyl)prop-2-enamide.
| Compound Name | (E)-N-[[(1R,3S)-3-ethoxy-1-hydroxy-2,2-dimethylcyclobutyl]methyl]-3-(5-methyl-3-pyridinyl)prop-2-enamide |
|---|---|
| PubChem CID | 129401802 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (E)-N-[[(1R,3S)-3-ethoxy-1-hydroxy-2,2-dimethylcyclobutyl]methyl]-3-(5-methyl-3-pyridinyl)prop-2-enamide |
| SMILES | CCO[C@H]1C[C@](O)(CNC(=O)/C=C/c2cncc(C)c2)C1(C)C |
| InChI | InChI=1S/C18H26N2O3/c1-5-23-15-9-18(22,17(15,3)4)12-20-16(21)7-6-14-8-13(2)10-19-11-14/h6-8,10-11,15,22H,5,9,12H2,1-4H3,(H,20,21)/b7-6+/t15-,18-/m0/s1 |
| InChIKey | KEUIETOVZXHVAI-MLCBILRFSA-N |
| XLogP | 2.09 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|