About (3R)-4'-(pyrimidin-2-ylmethyl)spiro[1,2-dihydroindene-3,2'-morpholine]
(3R)-4'-(pyrimidin-2-ylmethyl)spiro[1,2-dihydroindene-3,2'-morpholine] (PubChem CID 129402005) has the molecular formula C17H19N3O
and a molecular weight of 281.36 g/mol. Its IUPAC name is (3R)-4'-(pyrimidin-2-ylmethyl)spiro[1,2-dihydroindene-3,2'-morpholine].
Molecular Properties
| Compound Name | (3R)-4'-(pyrimidin-2-ylmethyl)spiro[1,2-dihydroindene-3,2'-morpholine] |
| PubChem CID | 129402005 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | (3R)-4'-(pyrimidin-2-ylmethyl)spiro[1,2-dihydroindene-3,2'-morpholine] |
| SMILES | c1cnc(CN2CCO[C@@]3(CCc4ccccc43)C2)nc1 |
| InChI | InChI=1S/C17H19N3O/c1-2-5-15-14(4-1)6-7-17(15)13-20(10-11-21-17)12-16-18-8-3-9-19-16/h1-5,8-9H,6-7,10-13H2/t17-/m0/s1 |
| InChIKey | BSELSVWORIFSIQ-KRWDZBQOSA-N |
| XLogP | 2.15 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-4'-(pyrimidin-2-ylmethyl)spiro[1,2-dihydroindene-3,2'-morpholine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-4'-(pyrimidin-2-ylmethyl)spiro[1,2-dihydroindene-3,2'-morpholine]?
The IUPAC name of (3R)-4'-(pyrimidin-2-ylmethyl)spiro[1,2-dihydroindene-3,2'-morpholine] (CID 129402005) is (3R)-4'-(pyrimidin-2-ylmethyl)spiro[1,2-dihydroindene-3,2'-morpholine].
What is the SMILES notation for (3R)-4'-(pyrimidin-2-ylmethyl)spiro[1,2-dihydroindene-3,2'-morpholine]?
The canonical SMILES for (3R)-4'-(pyrimidin-2-ylmethyl)spiro[1,2-dihydroindene-3,2'-morpholine] is c1cnc(CN2CCO[C@@]3(CCc4ccccc43)C2)nc1.
What is the InChIKey of (3R)-4'-(pyrimidin-2-ylmethyl)spiro[1,2-dihydroindene-3,2'-morpholine]?
The InChIKey is BSELSVWORIFSIQ-KRWDZBQOSA-N. The full InChI is InChI=1S/C17H19N3O/c1-2-5-15-14(4-1)6-7-17(15)13-20(10-11-21-17)12-16-18-8-3-9-19-16/h1-5,8-9H,6-7,10-13H2/t17-/m0/s1.
What are the key properties of (3R)-4'-(pyrimidin-2-ylmethyl)spiro[1,2-dihydroindene-3,2'-morpholine]?
(3R)-4'-(pyrimidin-2-ylmethyl)spiro[1,2-dihydroindene-3,2'-morpholine] has a molecular weight of 281.36 g/mol, XLogP of 2.15, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-4'-(pyrimidin-2-ylmethyl)spiro[1,2-dihydroindene-3,2'-morpholine] is sourced from PubChem (CID 129402005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).