C19H17F3N2O3 — CID 129402092
2,4,5-trifluoro-3-hydroxy-N-[(3S)-1-[(4-methylphenyl)methyl]-2-oxopyrrolidin-3-yl]benzamide (PubChem CID 129402092) has the molecular formula C19H17F3N2O3 and a molecular weight of 378.35 g/mol. Its IUPAC name is 2,4,5-trifluoro-3-hydroxy-N-[(3S)-1-[(4-methylphenyl)methyl]-2-oxopyrrolidin-3-yl]benzamide.
| Compound Name | 2,4,5-trifluoro-3-hydroxy-N-[(3S)-1-[(4-methylphenyl)methyl]-2-oxopyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 129402092 |
| Molecular Formula | C19H17F3N2O3 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2,4,5-trifluoro-3-hydroxy-N-[(3S)-1-[(4-methylphenyl)methyl]-2-oxopyrrolidin-3-yl]benzamide |
| SMILES | Cc1ccc(CN2CC[C@H](NC(=O)c3cc(F)c(F)c(O)c3F)C2=O)cc1 |
| InChI | InChI=1S/C19H17F3N2O3/c1-10-2-4-11(5-3-10)9-24-7-6-14(19(24)27)23-18(26)12-8-13(20)16(22)17(25)15(12)21/h2-5,8,14,25H,6-7,9H2,1H3,(H,23,26)/t14-/m0/s1 |
| InChIKey | WRBDFMDTXDOHKP-AWEZNQCLSA-N |
| XLogP | 2.65 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|