C22H29N5O2 — CID 129402656
(3R)-5-oxo-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-1-(2,4,6-trimethylphenyl)pyrrolidine-3-carboxamide (PubChem CID 129402656) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is (3R)-5-oxo-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-1-(2,4,6-trimethylphenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R)-5-oxo-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-1-(2,4,6-trimethylphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 129402656 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | (3R)-5-oxo-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-1-(2,4,6-trimethylphenyl)pyrrolidine-3-carboxamide |
| SMILES | Cc1cc(C)c(N2C[C@H](C(=O)NCc3nnc4n3CCCCC4)CC2=O)c(C)c1 |
| InChI | InChI=1S/C22H29N5O2/c1-14-9-15(2)21(16(3)10-14)27-13-17(11-20(27)28)22(29)23-12-19-25-24-18-7-5-4-6-8-26(18)19/h9-10,17H,4-8,11-13H2,1-3H3,(H,23,29)/t17-/m1/s1 |
| InChIKey | YPEYPILMAYBMDP-QGZVFWFLSA-N |
| XLogP | 2.60 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |