About N-[[4-[[(1R,3R)-3-cyanocyclohexyl]amino]phenyl]methyl]methanesulfonamide
N-[[4-[[(1R,3R)-3-cyanocyclohexyl]amino]phenyl]methyl]methanesulfonamide (PubChem CID 129402696) has the molecular formula C15H21N3O2S
and a molecular weight of 307.42 g/mol. Its IUPAC name is N-[[4-[[(1R,3R)-3-cyanocyclohexyl]amino]phenyl]methyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[[4-[[(1R,3R)-3-cyanocyclohexyl]amino]phenyl]methyl]methanesulfonamide |
| PubChem CID | 129402696 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | N-[[4-[[(1R,3R)-3-cyanocyclohexyl]amino]phenyl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCc1ccc(N[C@@H]2CCC[C@@H](C#N)C2)cc1 |
| InChI | InChI=1S/C15H21N3O2S/c1-21(19,20)17-11-12-5-7-14(8-6-12)18-15-4-2-3-13(9-15)10-16/h5-8,13,15,17-18H,2-4,9,11H2,1H3/t13-,15-/m1/s1 |
| InChIKey | QOWIRGNCZREAOR-UKRRQHHQSA-N |
| XLogP | 2.23 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[4-[[(1R,3R)-3-cyanocyclohexyl]amino]phenyl]methyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-[[(1R,3R)-3-cyanocyclohexyl]amino]phenyl]methyl]methanesulfonamide?
The IUPAC name of N-[[4-[[(1R,3R)-3-cyanocyclohexyl]amino]phenyl]methyl]methanesulfonamide (CID 129402696) is N-[[4-[[(1R,3R)-3-cyanocyclohexyl]amino]phenyl]methyl]methanesulfonamide.
What is the SMILES notation for N-[[4-[[(1R,3R)-3-cyanocyclohexyl]amino]phenyl]methyl]methanesulfonamide?
The canonical SMILES for N-[[4-[[(1R,3R)-3-cyanocyclohexyl]amino]phenyl]methyl]methanesulfonamide is CS(=O)(=O)NCc1ccc(N[C@@H]2CCC[C@@H](C#N)C2)cc1.
What is the InChIKey of N-[[4-[[(1R,3R)-3-cyanocyclohexyl]amino]phenyl]methyl]methanesulfonamide?
The InChIKey is QOWIRGNCZREAOR-UKRRQHHQSA-N. The full InChI is InChI=1S/C15H21N3O2S/c1-21(19,20)17-11-12-5-7-14(8-6-12)18-15-4-2-3-13(9-15)10-16/h5-8,13,15,17-18H,2-4,9,11H2,1H3/t13-,15-/m1/s1.
What are the key properties of N-[[4-[[(1R,3R)-3-cyanocyclohexyl]amino]phenyl]methyl]methanesulfonamide?
N-[[4-[[(1R,3R)-3-cyanocyclohexyl]amino]phenyl]methyl]methanesulfonamide has a molecular weight of 307.42 g/mol, XLogP of 2.23, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-[[(1R,3R)-3-cyanocyclohexyl]amino]phenyl]methyl]methanesulfonamide is sourced from PubChem (CID 129402696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).