C18H17N3OS — CID 129402819
(2R)-N,2-dipyridin-3-yl-N-(thiophen-3-ylmethyl)propanamide (PubChem CID 129402819) has the molecular formula C18H17N3OS and a molecular weight of 323.42 g/mol. Its IUPAC name is (2R)-N,2-dipyridin-3-yl-N-(thiophen-3-ylmethyl)propanamide.
| Compound Name | (2R)-N,2-dipyridin-3-yl-N-(thiophen-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 129402819 |
| Molecular Formula | C18H17N3OS |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | (2R)-N,2-dipyridin-3-yl-N-(thiophen-3-ylmethyl)propanamide |
| SMILES | C[C@@H](C(=O)N(Cc1ccsc1)c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C18H17N3OS/c1-14(16-4-2-7-19-10-16)18(22)21(12-15-6-9-23-13-15)17-5-3-8-20-11-17/h2-11,13-14H,12H2,1H3/t14-/m1/s1 |
| InChIKey | XNSQBQPCYJYYOO-CQSZACIVSA-N |
| XLogP | 3.88 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |