C12H17BrO3 — CID 129402931
(2S)-1-(2-bromo-4-methylphenoxy)-3-ethoxypropan-2-ol (PubChem CID 129402931) has the molecular formula C12H17BrO3 and a molecular weight of 289.17 g/mol. Its IUPAC name is (2S)-1-(2-bromo-4-methylphenoxy)-3-ethoxypropan-2-ol.
| Compound Name | (2S)-1-(2-bromo-4-methylphenoxy)-3-ethoxypropan-2-ol |
|---|---|
| PubChem CID | 129402931 |
| Molecular Formula | C12H17BrO3 |
| Molecular Weight | 289.17 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | (2S)-1-(2-bromo-4-methylphenoxy)-3-ethoxypropan-2-ol |
| SMILES | CCOC[C@H](O)COc1ccc(C)cc1Br |
| InChI | InChI=1S/C12H17BrO3/c1-3-15-7-10(14)8-16-12-5-4-9(2)6-11(12)13/h4-6,10,14H,3,7-8H2,1-2H3/t10-/m0/s1 |
| InChIKey | LMWQSHDSEIDSBG-JTQLQIEISA-N |
| XLogP | 2.53 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.17 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |