C10H11ClN2O — CID 129403037
[(1R)-4-chloro-2,3-dihydro-1H-inden-1-yl]urea (PubChem CID 129403037) has the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. Its IUPAC name is [(1R)-4-chloro-2,3-dihydro-1H-inden-1-yl]urea.
| Compound Name | [(1R)-4-chloro-2,3-dihydro-1H-inden-1-yl]urea |
|---|---|
| PubChem CID | 129403037 |
| Molecular Formula | C10H11ClN2O |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | [(1R)-4-chloro-2,3-dihydro-1H-inden-1-yl]urea |
| SMILES | NC(=O)N[C@@H]1CCc2c(Cl)cccc21 |
| InChI | InChI=1S/C10H11ClN2O/c11-8-3-1-2-7-6(8)4-5-9(7)13-10(12)14/h1-3,9H,4-5H2,(H3,12,13,14)/t9-/m1/s1 |
| InChIKey | AIKJONMPRYDHIM-SECBINFHSA-N |
| XLogP | 2.00 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |