C12H26O2Si — CID 129403734
(Z,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-en-1-ol (PubChem CID 129403734) has the molecular formula C12H26O2Si and a molecular weight of 230.42 g/mol. Its IUPAC name is (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-en-1-ol.
| Compound Name | (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-en-1-ol |
|---|---|
| PubChem CID | 129403734 |
| Molecular Formula | C12H26O2Si |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-en-1-ol |
| SMILES | C[C@H](C/C=C\CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H26O2Si/c1-11(9-7-8-10-13)14-15(5,6)12(2,3)4/h7-8,11,13H,9-10H2,1-6H3/b8-7-/t11-/m1/s1 |
| InChIKey | XVQJCIIATZRUJV-SKVAFPRGSA-N |
| XLogP | 3.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|