C9H13N3O — CID 129403766
[(E)-cycloocta-2,6-dien-1-ylideneamino]urea (PubChem CID 129403766) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is [(E)-cycloocta-2,6-dien-1-ylideneamino]urea.
| Compound Name | [(E)-cycloocta-2,6-dien-1-ylideneamino]urea |
|---|---|
| PubChem CID | 129403766 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | [(E)-cycloocta-2,6-dien-1-ylideneamino]urea |
| SMILES | NC(=O)N/N=C1/C=CCCC=CC1 |
| InChI | InChI=1S/C9H13N3O/c10-9(13)12-11-8-6-4-2-1-3-5-7-8/h2,4-5,7H,1,3,6H2,(H3,10,12,13)/b4-2?,7-5?,11-8+ |
| InChIKey | CHLUUKWFISHSAN-CPFOSSIXSA-N |
| XLogP | 1.31 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|