C8H8Br2 — CID 129403973
(1R,6R,7R,8S)-7,8-dibromobicyclo[4.2.0]octa-2,4-diene (PubChem CID 129403973) has the molecular formula C8H8Br2 and a molecular weight of 263.96 g/mol. Its IUPAC name is (1R,6R,7R,8S)-7,8-dibromobicyclo[4.2.0]octa-2,4-diene.
| Compound Name | (1R,6R,7R,8S)-7,8-dibromobicyclo[4.2.0]octa-2,4-diene |
|---|---|
| PubChem CID | 129403973 |
| Molecular Formula | C8H8Br2 |
| Molecular Weight | 263.96 g/mol |
| Exact Mass | 261.90 |
| IUPAC Name | (1R,6R,7R,8S)-7,8-dibromobicyclo[4.2.0]octa-2,4-diene |
| SMILES | Br[C@@H]1[C@H](Br)[C@@H]2C=CC=C[C@@H]12 |
| InChI | InChI=1S/C8H8Br2/c9-7-5-3-1-2-4-6(5)8(7)10/h1-8H/t5-,6-,7-,8+/m1/s1 |
| InChIKey | ROPLZHPSTKRFJJ-XUTVFYLZSA-N |
| XLogP | 2.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.96 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|