About ethyl (2R)-6-cyclohexyl-3,4-dihydro-2H-chromene-2-carboxylate
ethyl (2R)-6-cyclohexyl-3,4-dihydro-2H-chromene-2-carboxylate (PubChem CID 129404920) has the molecular formula C18H24O3
and a molecular weight of 288.39 g/mol. Its IUPAC name is ethyl (2R)-6-cyclohexyl-3,4-dihydro-2H-chromene-2-carboxylate.
Molecular Properties
| Compound Name | ethyl (2R)-6-cyclohexyl-3,4-dihydro-2H-chromene-2-carboxylate |
| PubChem CID | 129404920 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | ethyl (2R)-6-cyclohexyl-3,4-dihydro-2H-chromene-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCc2cc(C3CCCCC3)ccc2O1 |
| InChI | InChI=1S/C18H24O3/c1-2-20-18(19)17-11-9-15-12-14(8-10-16(15)21-17)13-6-4-3-5-7-13/h8,10,12-13,17H,2-7,9,11H2,1H3/t17-/m1/s1 |
| InChIKey | JCLQGSYIUAMKQM-QGZVFWFLSA-N |
| XLogP | 3.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl (2R)-6-cyclohexyl-3,4-dihydro-2H-chromene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R)-6-cyclohexyl-3,4-dihydro-2H-chromene-2-carboxylate?
The IUPAC name of ethyl (2R)-6-cyclohexyl-3,4-dihydro-2H-chromene-2-carboxylate (CID 129404920) is ethyl (2R)-6-cyclohexyl-3,4-dihydro-2H-chromene-2-carboxylate.
What is the SMILES notation for ethyl (2R)-6-cyclohexyl-3,4-dihydro-2H-chromene-2-carboxylate?
The canonical SMILES for ethyl (2R)-6-cyclohexyl-3,4-dihydro-2H-chromene-2-carboxylate is CCOC(=O)[C@H]1CCc2cc(C3CCCCC3)ccc2O1.
What is the InChIKey of ethyl (2R)-6-cyclohexyl-3,4-dihydro-2H-chromene-2-carboxylate?
The InChIKey is JCLQGSYIUAMKQM-QGZVFWFLSA-N. The full InChI is InChI=1S/C18H24O3/c1-2-20-18(19)17-11-9-15-12-14(8-10-16(15)21-17)13-6-4-3-5-7-13/h8,10,12-13,17H,2-7,9,11H2,1H3/t17-/m1/s1.
What are the key properties of ethyl (2R)-6-cyclohexyl-3,4-dihydro-2H-chromene-2-carboxylate?
ethyl (2R)-6-cyclohexyl-3,4-dihydro-2H-chromene-2-carboxylate has a molecular weight of 288.39 g/mol, XLogP of 3.99, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R)-6-cyclohexyl-3,4-dihydro-2H-chromene-2-carboxylate is sourced from PubChem (CID 129404920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).