C17H21NO2 — CID 129405053
3-[(1R)-1,9-dimethyl-3,4-dihydro-2H-carbazol-1-yl]propanoic acid (PubChem CID 129405053) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 3-[(1R)-1,9-dimethyl-3,4-dihydro-2H-carbazol-1-yl]propanoic acid.
| Compound Name | 3-[(1R)-1,9-dimethyl-3,4-dihydro-2H-carbazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 129405053 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 3-[(1R)-1,9-dimethyl-3,4-dihydro-2H-carbazol-1-yl]propanoic acid |
| SMILES | Cn1c2c(c3ccccc31)CCC[C@]2(C)CCC(=O)O |
| InChI | InChI=1S/C17H21NO2/c1-17(11-9-15(19)20)10-5-7-13-12-6-3-4-8-14(12)18(2)16(13)17/h3-4,6,8H,5,7,9-11H2,1-2H3,(H,19,20)/t17-/m1/s1 |
| InChIKey | SRQVYJWIPBLELC-QGZVFWFLSA-N |
| XLogP | 3.64 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |