About (1R)-5-fluoro-1'-methyl-1-phenylspiro[1H-2-benzofuran-3,4'-piperidine]
(1R)-5-fluoro-1'-methyl-1-phenylspiro[1H-2-benzofuran-3,4'-piperidine] (PubChem CID 129405189) has the molecular formula C19H20FNO
and a molecular weight of 297.37 g/mol. Its IUPAC name is (1R)-5-fluoro-1'-methyl-1-phenylspiro[1H-2-benzofuran-3,4'-piperidine].
Molecular Properties
| Compound Name | (1R)-5-fluoro-1'-methyl-1-phenylspiro[1H-2-benzofuran-3,4'-piperidine] |
| PubChem CID | 129405189 |
| Molecular Formula | C19H20FNO |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | (1R)-5-fluoro-1'-methyl-1-phenylspiro[1H-2-benzofuran-3,4'-piperidine] |
| SMILES | CN1CCC2(CC1)O[C@H](c1ccccc1)c1ccc(F)cc12 |
| InChI | InChI=1S/C19H20FNO/c1-21-11-9-19(10-12-21)17-13-15(20)7-8-16(17)18(22-19)14-5-3-2-4-6-14/h2-8,13,18H,9-12H2,1H3/t18-/m1/s1 |
| InChIKey | VIZGADDGVICNRY-GOSISDBHSA-N |
| XLogP | 3.87 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R)-5-fluoro-1'-methyl-1-phenylspiro[1H-2-benzofuran-3,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-5-fluoro-1'-methyl-1-phenylspiro[1H-2-benzofuran-3,4'-piperidine]?
The IUPAC name of (1R)-5-fluoro-1'-methyl-1-phenylspiro[1H-2-benzofuran-3,4'-piperidine] (CID 129405189) is (1R)-5-fluoro-1'-methyl-1-phenylspiro[1H-2-benzofuran-3,4'-piperidine].
What is the SMILES notation for (1R)-5-fluoro-1'-methyl-1-phenylspiro[1H-2-benzofuran-3,4'-piperidine]?
The canonical SMILES for (1R)-5-fluoro-1'-methyl-1-phenylspiro[1H-2-benzofuran-3,4'-piperidine] is CN1CCC2(CC1)O[C@H](c1ccccc1)c1ccc(F)cc12.
What is the InChIKey of (1R)-5-fluoro-1'-methyl-1-phenylspiro[1H-2-benzofuran-3,4'-piperidine]?
The InChIKey is VIZGADDGVICNRY-GOSISDBHSA-N. The full InChI is InChI=1S/C19H20FNO/c1-21-11-9-19(10-12-21)17-13-15(20)7-8-16(17)18(22-19)14-5-3-2-4-6-14/h2-8,13,18H,9-12H2,1H3/t18-/m1/s1.
What are the key properties of (1R)-5-fluoro-1'-methyl-1-phenylspiro[1H-2-benzofuran-3,4'-piperidine]?
(1R)-5-fluoro-1'-methyl-1-phenylspiro[1H-2-benzofuran-3,4'-piperidine] has a molecular weight of 297.37 g/mol, XLogP of 3.87, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-5-fluoro-1'-methyl-1-phenylspiro[1H-2-benzofuran-3,4'-piperidine] is sourced from PubChem (CID 129405189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).