C11H14N2 — CID 129405648
(1S,8S)-tricyclo[6.2.1.02,7]undeca-2,4,6-triene-4,5-diamine (PubChem CID 129405648) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is (1S,8S)-tricyclo[6.2.1.02,7]undeca-2,4,6-triene-4,5-diamine.
| Compound Name | (1S,8S)-tricyclo[6.2.1.02,7]undeca-2,4,6-triene-4,5-diamine |
|---|---|
| PubChem CID | 129405648 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | (1S,8S)-tricyclo[6.2.1.02,7]undeca-2,4,6-triene-4,5-diamine |
| SMILES | Nc1cc2c(cc1N)[C@H]1CC[C@H]2C1 |
| InChI | InChI=1S/C11H14N2/c12-10-4-8-6-1-2-7(3-6)9(8)5-11(10)13/h4-7H,1-3,12-13H2/t6-,7-/m0/s1 |
| InChIKey | YOZDIIWLNQIOFN-BQBZGAKWSA-N |
| XLogP | 2.22 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|