C12H14O3 — CID 129405830
(5S)-2,2,5-trimethyl-5-phenyl-1,3-dioxolan-4-one (PubChem CID 129405830) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is (5S)-2,2,5-trimethyl-5-phenyl-1,3-dioxolan-4-one.
| Compound Name | (5S)-2,2,5-trimethyl-5-phenyl-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 129405830 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (5S)-2,2,5-trimethyl-5-phenyl-1,3-dioxolan-4-one |
| SMILES | CC1(C)OC(=O)[C@](C)(c2ccccc2)O1 |
| InChI | InChI=1S/C12H14O3/c1-11(2)14-10(13)12(3,15-11)9-7-5-4-6-8-9/h4-8H,1-3H3/t12-/m0/s1 |
| InChIKey | YNXZMAKSVGXYSS-LBPRGKRZSA-N |
| XLogP | 2.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |