C14H14ClNO4 — CID 129407880
(3S)-4-[(Z)-3-(4-chlorophenyl)prop-2-enoyl]morpholine-3-carboxylic acid (PubChem CID 129407880) has the molecular formula C14H14ClNO4 and a molecular weight of 295.72 g/mol. Its IUPAC name is (3S)-4-[(Z)-3-(4-chlorophenyl)prop-2-enoyl]morpholine-3-carboxylic acid.
| Compound Name | (3S)-4-[(Z)-3-(4-chlorophenyl)prop-2-enoyl]morpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 129407880 |
| Molecular Formula | C14H14ClNO4 |
| Molecular Weight | 295.72 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | (3S)-4-[(Z)-3-(4-chlorophenyl)prop-2-enoyl]morpholine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1COCCN1C(=O)/C=C\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H14ClNO4/c15-11-4-1-10(2-5-11)3-6-13(17)16-7-8-20-9-12(16)14(18)19/h1-6,12H,7-9H2,(H,18,19)/b6-3-/t12-/m0/s1 |
| InChIKey | KRLIEZDWUQKRCJ-RYBZSIHZSA-N |
| XLogP | 1.67 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.72 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|