C9H10BrF3N2 — CID 129408237
(2R)-N-[(2-bromo-4-pyridinyl)methyl]-1,1,1-trifluoropropan-2-amine (PubChem CID 129408237) has the molecular formula C9H10BrF3N2 and a molecular weight of 283.09 g/mol. Its IUPAC name is (2R)-N-[(2-bromo-4-pyridinyl)methyl]-1,1,1-trifluoropropan-2-amine.
| Compound Name | (2R)-N-[(2-bromo-4-pyridinyl)methyl]-1,1,1-trifluoropropan-2-amine |
|---|---|
| PubChem CID | 129408237 |
| Molecular Formula | C9H10BrF3N2 |
| Molecular Weight | 283.09 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | (2R)-N-[(2-bromo-4-pyridinyl)methyl]-1,1,1-trifluoropropan-2-amine |
| SMILES | C[C@@H](NCc1ccnc(Br)c1)C(F)(F)F |
| InChI | InChI=1S/C9H10BrF3N2/c1-6(9(11,12)13)15-5-7-2-3-14-8(10)4-7/h2-4,6,15H,5H2,1H3/t6-/m1/s1 |
| InChIKey | UJPQDDVUZFTPFZ-ZCFIWIBFSA-N |
| XLogP | 2.88 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.09 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|