About [2-[(1R,6S)-1-ethoxycarbonyl-3-azabicyclo[4.1.0]heptan-3-yl]pyrimidin-5-yl]boronic acid
[2-[(1R,6S)-1-ethoxycarbonyl-3-azabicyclo[4.1.0]heptan-3-yl]pyrimidin-5-yl]boronic acid (PubChem CID 129409699) has the molecular formula C13H18BN3O4
and a molecular weight of 291.12 g/mol. Its IUPAC name is [2-[(1R,6S)-1-ethoxycarbonyl-3-azabicyclo[4.1.0]heptan-3-yl]pyrimidin-5-yl]boronic acid.
Molecular Properties
| Compound Name | [2-[(1R,6S)-1-ethoxycarbonyl-3-azabicyclo[4.1.0]heptan-3-yl]pyrimidin-5-yl]boronic acid |
| PubChem CID | 129409699 |
| Molecular Formula | C13H18BN3O4 |
| Molecular Weight | 291.12 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | [2-[(1R,6S)-1-ethoxycarbonyl-3-azabicyclo[4.1.0]heptan-3-yl]pyrimidin-5-yl]boronic acid |
| SMILES | CCOC(=O)[C@]12C[C@H]1CCN(c1ncc(B(O)O)cn1)C2 |
| InChI | InChI=1S/C13H18BN3O4/c1-2-21-11(18)13-5-9(13)3-4-17(8-13)12-15-6-10(7-16-12)14(19)20/h6-7,9,19-20H,2-5,8H2,1H3/t9-,13+/m1/s1 |
| InChIKey | NSOLVUZUGXWAFX-RNCFNFMXSA-N |
| XLogP | -1.06 |
| TPSA | 95.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.12 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2-[(1R,6S)-1-ethoxycarbonyl-3-azabicyclo[4.1.0]heptan-3-yl]pyrimidin-5-yl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(1R,6S)-1-ethoxycarbonyl-3-azabicyclo[4.1.0]heptan-3-yl]pyrimidin-5-yl]boronic acid?
The IUPAC name of [2-[(1R,6S)-1-ethoxycarbonyl-3-azabicyclo[4.1.0]heptan-3-yl]pyrimidin-5-yl]boronic acid (CID 129409699) is [2-[(1R,6S)-1-ethoxycarbonyl-3-azabicyclo[4.1.0]heptan-3-yl]pyrimidin-5-yl]boronic acid.
What is the SMILES notation for [2-[(1R,6S)-1-ethoxycarbonyl-3-azabicyclo[4.1.0]heptan-3-yl]pyrimidin-5-yl]boronic acid?
The canonical SMILES for [2-[(1R,6S)-1-ethoxycarbonyl-3-azabicyclo[4.1.0]heptan-3-yl]pyrimidin-5-yl]boronic acid is CCOC(=O)[C@]12C[C@H]1CCN(c1ncc(B(O)O)cn1)C2.
What is the InChIKey of [2-[(1R,6S)-1-ethoxycarbonyl-3-azabicyclo[4.1.0]heptan-3-yl]pyrimidin-5-yl]boronic acid?
The InChIKey is NSOLVUZUGXWAFX-RNCFNFMXSA-N. The full InChI is InChI=1S/C13H18BN3O4/c1-2-21-11(18)13-5-9(13)3-4-17(8-13)12-15-6-10(7-16-12)14(19)20/h6-7,9,19-20H,2-5,8H2,1H3/t9-,13+/m1/s1.
What are the key properties of [2-[(1R,6S)-1-ethoxycarbonyl-3-azabicyclo[4.1.0]heptan-3-yl]pyrimidin-5-yl]boronic acid?
[2-[(1R,6S)-1-ethoxycarbonyl-3-azabicyclo[4.1.0]heptan-3-yl]pyrimidin-5-yl]boronic acid has a molecular weight of 291.12 g/mol, XLogP of -1.06, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(1R,6S)-1-ethoxycarbonyl-3-azabicyclo[4.1.0]heptan-3-yl]pyrimidin-5-yl]boronic acid is sourced from PubChem (CID 129409699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).