C11H12N4OS — CID 129410149
(1R)-9-amino-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzothiazin-2-one (PubChem CID 129410149) has the molecular formula C11H12N4OS and a molecular weight of 248.31 g/mol. Its IUPAC name is (1R)-9-amino-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzothiazin-2-one.
| Compound Name | (1R)-9-amino-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzothiazin-2-one |
|---|---|
| PubChem CID | 129410149 |
| Molecular Formula | C11H12N4OS |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | (1R)-9-amino-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzothiazin-2-one |
| SMILES | C[C@@H]1C(=O)NN=C2CSc3ccc(N)cc3N21 |
| InChI | InChI=1S/C11H12N4OS/c1-6-11(16)14-13-10-5-17-9-3-2-7(12)4-8(9)15(6)10/h2-4,6H,5,12H2,1H3,(H,14,16)/t6-/m1/s1 |
| InChIKey | MHLQMQPYGRGIOP-ZCFIWIBFSA-N |
| XLogP | 1.01 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|