About ethyl (Z)-6-nitrohex-2-enoate
ethyl (Z)-6-nitrohex-2-enoate (PubChem CID 129410599) has the molecular formula C8H13NO4
and a molecular weight of 187.19 g/mol. Its IUPAC name is ethyl (Z)-6-nitrohex-2-enoate.
Molecular Properties
| Compound Name | ethyl (Z)-6-nitrohex-2-enoate |
| PubChem CID | 129410599 |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | ethyl (Z)-6-nitrohex-2-enoate |
| SMILES | CCOC(=O)/C=C\CCC[N+](=O)[O-] |
| InChI | InChI=1S/C8H13NO4/c1-2-13-8(10)6-4-3-5-7-9(11)12/h4,6H,2-3,5,7H2,1H3/b6-4- |
| InChIKey | ONVJXQUHLADUIG-XQRVVYSFSA-N |
| XLogP | 1.16 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl (Z)-6-nitrohex-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (Z)-6-nitrohex-2-enoate?
The IUPAC name of ethyl (Z)-6-nitrohex-2-enoate (CID 129410599) is ethyl (Z)-6-nitrohex-2-enoate.
What is the SMILES notation for ethyl (Z)-6-nitrohex-2-enoate?
The canonical SMILES for ethyl (Z)-6-nitrohex-2-enoate is CCOC(=O)/C=C\CCC[N+](=O)[O-].
What is the InChIKey of ethyl (Z)-6-nitrohex-2-enoate?
The InChIKey is ONVJXQUHLADUIG-XQRVVYSFSA-N. The full InChI is InChI=1S/C8H13NO4/c1-2-13-8(10)6-4-3-5-7-9(11)12/h4,6H,2-3,5,7H2,1H3/b6-4-.
What are the key properties of ethyl (Z)-6-nitrohex-2-enoate?
ethyl (Z)-6-nitrohex-2-enoate has a molecular weight of 187.19 g/mol, XLogP of 1.16, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (Z)-6-nitrohex-2-enoate is sourced from PubChem (CID 129410599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).