C13H17Br — CID 129411437
(1S)-4-bromo-1-tert-butyl-2,3-dihydro-1H-indene (PubChem CID 129411437) has the molecular formula C13H17Br and a molecular weight of 253.18 g/mol. Its IUPAC name is (1S)-4-bromo-1-tert-butyl-2,3-dihydro-1H-indene.
| Compound Name | (1S)-4-bromo-1-tert-butyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 129411437 |
| Molecular Formula | C13H17Br |
| Molecular Weight | 253.18 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | (1S)-4-bromo-1-tert-butyl-2,3-dihydro-1H-indene |
| SMILES | CC(C)(C)[C@@H]1CCc2c(Br)cccc21 |
| InChI | InChI=1S/C13H17Br/c1-13(2,3)11-8-7-10-9(11)5-4-6-12(10)14/h4-6,11H,7-8H2,1-3H3/t11-/m1/s1 |
| InChIKey | HOODEZXWIYNQJA-LLVKDONJSA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.18 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |