About 1-bromo-4-[[(1S)-2,2-difluorocyclopropyl]methoxy]-2-methoxybenzene
1-bromo-4-[[(1S)-2,2-difluorocyclopropyl]methoxy]-2-methoxybenzene (PubChem CID 129411725) has the molecular formula C11H11BrF2O2
and a molecular weight of 293.11 g/mol. Its IUPAC name is 1-bromo-4-[[(1S)-2,2-difluorocyclopropyl]methoxy]-2-methoxybenzene.
Molecular Properties
| Compound Name | 1-bromo-4-[[(1S)-2,2-difluorocyclopropyl]methoxy]-2-methoxybenzene |
| PubChem CID | 129411725 |
| Molecular Formula | C11H11BrF2O2 |
| Molecular Weight | 293.11 g/mol |
| Exact Mass | 291.99 |
| IUPAC Name | 1-bromo-4-[[(1S)-2,2-difluorocyclopropyl]methoxy]-2-methoxybenzene |
| SMILES | COc1cc(OC[C@@H]2CC2(F)F)ccc1Br |
| InChI | InChI=1S/C11H11BrF2O2/c1-15-10-4-8(2-3-9(10)12)16-6-7-5-11(7,13)14/h2-4,7H,5-6H2,1H3/t7-/m0/s1 |
| InChIKey | PTBOXHIHRCUJIQ-ZETCQYMHSA-N |
| XLogP | 3.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.11 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-bromo-4-[[(1S)-2,2-difluorocyclopropyl]methoxy]-2-methoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-[[(1S)-2,2-difluorocyclopropyl]methoxy]-2-methoxybenzene?
The IUPAC name of 1-bromo-4-[[(1S)-2,2-difluorocyclopropyl]methoxy]-2-methoxybenzene (CID 129411725) is 1-bromo-4-[[(1S)-2,2-difluorocyclopropyl]methoxy]-2-methoxybenzene.
What is the SMILES notation for 1-bromo-4-[[(1S)-2,2-difluorocyclopropyl]methoxy]-2-methoxybenzene?
The canonical SMILES for 1-bromo-4-[[(1S)-2,2-difluorocyclopropyl]methoxy]-2-methoxybenzene is COc1cc(OC[C@@H]2CC2(F)F)ccc1Br.
What is the InChIKey of 1-bromo-4-[[(1S)-2,2-difluorocyclopropyl]methoxy]-2-methoxybenzene?
The InChIKey is PTBOXHIHRCUJIQ-ZETCQYMHSA-N. The full InChI is InChI=1S/C11H11BrF2O2/c1-15-10-4-8(2-3-9(10)12)16-6-7-5-11(7,13)14/h2-4,7H,5-6H2,1H3/t7-/m0/s1.
What are the key properties of 1-bromo-4-[[(1S)-2,2-difluorocyclopropyl]methoxy]-2-methoxybenzene?
1-bromo-4-[[(1S)-2,2-difluorocyclopropyl]methoxy]-2-methoxybenzene has a molecular weight of 293.11 g/mol, XLogP of 3.49, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-[[(1S)-2,2-difluorocyclopropyl]methoxy]-2-methoxybenzene is sourced from PubChem (CID 129411725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).