C11H9F3N2O4S — CID 129411858
3-(N-cyano-S-methylsulfonimidoyl)-2-methoxy-4-(trifluoromethyl)benzoic acid (PubChem CID 129411858) has the molecular formula C11H9F3N2O4S and a molecular weight of 322.26 g/mol. Its IUPAC name is 3-(N-cyano-S-methylsulfonimidoyl)-2-methoxy-4-(trifluoromethyl)benzoic acid.
| Compound Name | 3-(N-cyano-S-methylsulfonimidoyl)-2-methoxy-4-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 129411858 |
| Molecular Formula | C11H9F3N2O4S |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 3-(N-cyano-S-methylsulfonimidoyl)-2-methoxy-4-(trifluoromethyl)benzoic acid |
| SMILES | COc1c(C(=O)O)ccc(C(F)(F)F)c1[S@](C)(=O)=NC#N |
| InChI | InChI=1S/C11H9F3N2O4S/c1-20-8-6(10(17)18)3-4-7(11(12,13)14)9(8)21(2,19)16-5-15/h3-4H,1-2H3,(H,17,18)/t21-/m0/s1 |
| InChIKey | KQILQMUEAWWUNI-NRFANRHFSA-N |
| XLogP | 2.35 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|