About (3R)-3-[(E,1R)-1-hydroxybut-2-enyl]-1-phenylpyrrolidin-2-one
(3R)-3-[(E,1R)-1-hydroxybut-2-enyl]-1-phenylpyrrolidin-2-one (PubChem CID 129411928) has the molecular formula C14H17NO2
and a molecular weight of 231.30 g/mol. Its IUPAC name is (3R)-3-[(E,1R)-1-hydroxybut-2-enyl]-1-phenylpyrrolidin-2-one.
Molecular Properties
| Compound Name | (3R)-3-[(E,1R)-1-hydroxybut-2-enyl]-1-phenylpyrrolidin-2-one |
| PubChem CID | 129411928 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | (3R)-3-[(E,1R)-1-hydroxybut-2-enyl]-1-phenylpyrrolidin-2-one |
| SMILES | C/C=C/[C@@H](O)[C@H]1CCN(c2ccccc2)C1=O |
| InChI | InChI=1S/C14H17NO2/c1-2-6-13(16)12-9-10-15(14(12)17)11-7-4-3-5-8-11/h2-8,12-13,16H,9-10H2,1H3/b6-2+/t12-,13-/m1/s1 |
| InChIKey | XJWURNRGBMNCFW-CIWFBCQASA-N |
| XLogP | 1.98 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-[(E,1R)-1-hydroxybut-2-enyl]-1-phenylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-[(E,1R)-1-hydroxybut-2-enyl]-1-phenylpyrrolidin-2-one?
The IUPAC name of (3R)-3-[(E,1R)-1-hydroxybut-2-enyl]-1-phenylpyrrolidin-2-one (CID 129411928) is (3R)-3-[(E,1R)-1-hydroxybut-2-enyl]-1-phenylpyrrolidin-2-one.
What is the SMILES notation for (3R)-3-[(E,1R)-1-hydroxybut-2-enyl]-1-phenylpyrrolidin-2-one?
The canonical SMILES for (3R)-3-[(E,1R)-1-hydroxybut-2-enyl]-1-phenylpyrrolidin-2-one is C/C=C/[C@@H](O)[C@H]1CCN(c2ccccc2)C1=O.
What is the InChIKey of (3R)-3-[(E,1R)-1-hydroxybut-2-enyl]-1-phenylpyrrolidin-2-one?
The InChIKey is XJWURNRGBMNCFW-CIWFBCQASA-N. The full InChI is InChI=1S/C14H17NO2/c1-2-6-13(16)12-9-10-15(14(12)17)11-7-4-3-5-8-11/h2-8,12-13,16H,9-10H2,1H3/b6-2+/t12-,13-/m1/s1.
What are the key properties of (3R)-3-[(E,1R)-1-hydroxybut-2-enyl]-1-phenylpyrrolidin-2-one?
(3R)-3-[(E,1R)-1-hydroxybut-2-enyl]-1-phenylpyrrolidin-2-one has a molecular weight of 231.30 g/mol, XLogP of 1.98, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-[(E,1R)-1-hydroxybut-2-enyl]-1-phenylpyrrolidin-2-one is sourced from PubChem (CID 129411928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).