C14H14N2O — CID 129412804
[(1R,12R)-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaen-6-yl]methanol (PubChem CID 129412804) has the molecular formula C14H14N2O and a molecular weight of 226.28 g/mol. Its IUPAC name is [(1R,12R)-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaen-6-yl]methanol.
| Compound Name | [(1R,12R)-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaen-6-yl]methanol |
|---|---|
| PubChem CID | 129412804 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | [(1R,12R)-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaen-6-yl]methanol |
| SMILES | OCc1ccc2nc3c(nc2c1)[C@@H]1CC[C@@H]3C1 |
| InChI | InChI=1S/C14H14N2O/c17-7-8-1-4-11-12(5-8)16-14-10-3-2-9(6-10)13(14)15-11/h1,4-5,9-10,17H,2-3,6-7H2/t9-,10-/m1/s1 |
| InChIKey | OVVBWEHDEHIPHK-NXEZZACHSA-N |
| XLogP | 2.49 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |