C15H21N3O — CID 12941291
4,4-dimethyl-1-phenyl-2-(1,2,4-triazol-1-yl)pentan-3-ol (PubChem CID 12941291) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 4,4-dimethyl-1-phenyl-2-(1,2,4-triazol-1-yl)pentan-3-ol.
| Compound Name | 4,4-dimethyl-1-phenyl-2-(1,2,4-triazol-1-yl)pentan-3-ol |
|---|---|
| PubChem CID | 12941291 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 4,4-dimethyl-1-phenyl-2-(1,2,4-triazol-1-yl)pentan-3-ol |
| SMILES | CC(C)(C)C(O)C(Cc1ccccc1)n1cncn1 |
| InChI | InChI=1S/C15H21N3O/c1-15(2,3)14(19)13(18-11-16-10-17-18)9-12-7-5-4-6-8-12/h4-8,10-11,13-14,19H,9H2,1-3H3 |
| InChIKey | WCRHEKTUSCELCM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |