About 4-[(3R,4R)-3,4-dimethoxypyrrolidin-1-yl]aniline
4-[(3R,4R)-3,4-dimethoxypyrrolidin-1-yl]aniline (PubChem CID 129414434) has the molecular formula C12H18N2O2
and a molecular weight of 222.29 g/mol. Its IUPAC name is 4-[(3R,4R)-3,4-dimethoxypyrrolidin-1-yl]aniline.
Molecular Properties
| Compound Name | 4-[(3R,4R)-3,4-dimethoxypyrrolidin-1-yl]aniline |
| PubChem CID | 129414434 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 4-[(3R,4R)-3,4-dimethoxypyrrolidin-1-yl]aniline |
| SMILES | CO[C@@H]1CN(c2ccc(N)cc2)C[C@H]1OC |
| InChI | InChI=1S/C12H18N2O2/c1-15-11-7-14(8-12(11)16-2)10-5-3-9(13)4-6-10/h3-6,11-12H,7-8,13H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | UQPBKPAXHRNTNW-VXGBXAGGSA-N |
| XLogP | 1.12 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3R,4R)-3,4-dimethoxypyrrolidin-1-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3R,4R)-3,4-dimethoxypyrrolidin-1-yl]aniline?
The IUPAC name of 4-[(3R,4R)-3,4-dimethoxypyrrolidin-1-yl]aniline (CID 129414434) is 4-[(3R,4R)-3,4-dimethoxypyrrolidin-1-yl]aniline.
What is the SMILES notation for 4-[(3R,4R)-3,4-dimethoxypyrrolidin-1-yl]aniline?
The canonical SMILES for 4-[(3R,4R)-3,4-dimethoxypyrrolidin-1-yl]aniline is CO[C@@H]1CN(c2ccc(N)cc2)C[C@H]1OC.
What is the InChIKey of 4-[(3R,4R)-3,4-dimethoxypyrrolidin-1-yl]aniline?
The InChIKey is UQPBKPAXHRNTNW-VXGBXAGGSA-N. The full InChI is InChI=1S/C12H18N2O2/c1-15-11-7-14(8-12(11)16-2)10-5-3-9(13)4-6-10/h3-6,11-12H,7-8,13H2,1-2H3/t11-,12-/m1/s1.
What are the key properties of 4-[(3R,4R)-3,4-dimethoxypyrrolidin-1-yl]aniline?
4-[(3R,4R)-3,4-dimethoxypyrrolidin-1-yl]aniline has a molecular weight of 222.29 g/mol, XLogP of 1.12, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3R,4R)-3,4-dimethoxypyrrolidin-1-yl]aniline is sourced from PubChem (CID 129414434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).